C12H16BrF2NO — CID 171262488
(1R,2S)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol (PubChem CID 171262488) has the molecular formula C12H16BrF2NO and a molecular weight of 308.17 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol |
|---|---|
| PubChem CID | 171262488 |
| Molecular Formula | C12H16BrF2NO |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-bromo-2,6-difluorophenyl)hexan-2-ol |
| SMILES | CCCC[C@H](O)[C@H](N)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H16BrF2NO/c1-2-3-4-9(17)12(16)10-8(14)6-5-7(13)11(10)15/h5-6,9,12,17H,2-4,16H2,1H3/t9-,12-/m0/s1 |
| InChIKey | OYIHVIWNVZCBAR-CABZTGNLSA-N |
| XLogP | 3.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|