C15H23Cl2NO — CID 114754167
1-amino-2-(2,6-dichlorophenyl)nonan-3-ol (PubChem CID 114754167) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-amino-2-(2,6-dichlorophenyl)nonan-3-ol.
| Compound Name | 1-amino-2-(2,6-dichlorophenyl)nonan-3-ol |
|---|---|
| PubChem CID | 114754167 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-amino-2-(2,6-dichlorophenyl)nonan-3-ol |
| SMILES | CCCCCCC(O)C(CN)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H23Cl2NO/c1-2-3-4-5-9-14(19)11(10-18)15-12(16)7-6-8-13(15)17/h6-8,11,14,19H,2-5,9-10,18H2,1H3 |
| InChIKey | KHCQEWWXRCXRFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|