C17H27F2NO — CID 65427983
1-amino-2-(3,5-difluorophenyl)undecan-3-ol (PubChem CID 65427983) has the molecular formula C17H27F2NO and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-amino-2-(3,5-difluorophenyl)undecan-3-ol.
| Compound Name | 1-amino-2-(3,5-difluorophenyl)undecan-3-ol |
|---|---|
| PubChem CID | 65427983 |
| Molecular Formula | C17H27F2NO |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 1-amino-2-(3,5-difluorophenyl)undecan-3-ol |
| SMILES | CCCCCCCCC(O)C(CN)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H27F2NO/c1-2-3-4-5-6-7-8-17(21)16(12-20)13-9-14(18)11-15(19)10-13/h9-11,16-17,21H,2-8,12,20H2,1H3 |
| InChIKey | BYACADHLQFEJRS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|