C12H17Cl2NO4 — CID 163943329
amino-[(1R,2R)-1-(2,5-dichlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethanol (PubChem CID 163943329) has the molecular formula C12H17Cl2NO4 and a molecular weight of 310.18 g/mol. Its IUPAC name is amino-[(1R,2R)-1-(2,5-dichlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethanol.
| Compound Name | amino-[(1R,2R)-1-(2,5-dichlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethanol |
|---|---|
| PubChem CID | 163943329 |
| Molecular Formula | C12H17Cl2NO4 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | amino-[(1R,2R)-1-(2,5-dichlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethanol |
| SMILES | COCO[C@H](c1cc(Cl)ccc1Cl)[C@@H](C)OC(N)O |
| InChI | InChI=1S/C12H17Cl2NO4/c1-7(19-12(15)16)11(18-6-17-2)9-5-8(13)3-4-10(9)14/h3-5,7,11-12,16H,6,15H2,1-2H3/t7-,11+,12?/m1/s1 |
| InChIKey | RSYFSDGGUDQJBP-VDJVUWEHSA-N |
| XLogP | 2.29 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|