C18H25IO4 — CID 158379095
[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-cyclopropylacetate (PubChem CID 158379095) has the molecular formula C18H25IO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-cyclopropylacetate.
| Compound Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-cyclopropylacetate |
|---|---|
| PubChem CID | 158379095 |
| Molecular Formula | C18H25IO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-cyclopropylacetate |
| SMILES | COCO[C@@H](c1ccccc1I)[C@@H](OC(=O)CC1CC1)C(C)C |
| InChI | InChI=1S/C18H25IO4/c1-12(2)17(23-16(20)10-13-8-9-13)18(22-11-21-3)14-6-4-5-7-15(14)19/h4-7,12-13,17-18H,8-11H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | GVOJOLLLZAGIEZ-ROUUACIJSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|