C17H23IO3 — CID 159923582
[(1S,2S)-1-hydroxy-1-(2-iodophenyl)hexan-2-yl] 2-cyclopropylacetate (PubChem CID 159923582) has the molecular formula C17H23IO3 and a molecular weight of 402.27 g/mol. Its IUPAC name is [(1S,2S)-1-hydroxy-1-(2-iodophenyl)hexan-2-yl] 2-cyclopropylacetate.
| Compound Name | [(1S,2S)-1-hydroxy-1-(2-iodophenyl)hexan-2-yl] 2-cyclopropylacetate |
|---|---|
| PubChem CID | 159923582 |
| Molecular Formula | C17H23IO3 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [(1S,2S)-1-hydroxy-1-(2-iodophenyl)hexan-2-yl] 2-cyclopropylacetate |
| SMILES | CCCC[C@H](OC(=O)CC1CC1)[C@@H](O)c1ccccc1I |
| InChI | InChI=1S/C17H23IO3/c1-2-3-8-15(21-16(19)11-12-9-10-12)17(20)13-6-4-5-7-14(13)18/h4-7,12,15,17,20H,2-3,8-11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | NYSNPVILCICKNK-RDJZCZTQSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|