C16H23IO4 — CID 159564747
[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)propan-2-yl] pentanoate (PubChem CID 159564747) has the molecular formula C16H23IO4 and a molecular weight of 406.26 g/mol. Its IUPAC name is [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)propan-2-yl] pentanoate.
| Compound Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)propan-2-yl] pentanoate |
|---|---|
| PubChem CID | 159564747 |
| Molecular Formula | C16H23IO4 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)propan-2-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@H](C)[C@@H](OCOC)c1ccccc1I |
| InChI | InChI=1S/C16H23IO4/c1-4-5-10-15(18)21-12(2)16(20-11-19-3)13-8-6-7-9-14(13)17/h6-9,12,16H,4-5,10-11H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | MHBCIUQXZJRLGB-BLLLJJGKSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|