C18H25IO3 — CID 148885650
[(1S,2S)-1-(2-iodophenyl)-1-methoxyhexan-2-yl] 2-cyclopropylacetate (PubChem CID 148885650) has the molecular formula C18H25IO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is [(1S,2S)-1-(2-iodophenyl)-1-methoxyhexan-2-yl] 2-cyclopropylacetate.
| Compound Name | [(1S,2S)-1-(2-iodophenyl)-1-methoxyhexan-2-yl] 2-cyclopropylacetate |
|---|---|
| PubChem CID | 148885650 |
| Molecular Formula | C18H25IO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [(1S,2S)-1-(2-iodophenyl)-1-methoxyhexan-2-yl] 2-cyclopropylacetate |
| SMILES | CCCC[C@H](OC(=O)CC1CC1)[C@@H](OC)c1ccccc1I |
| InChI | InChI=1S/C18H25IO3/c1-3-4-9-16(22-17(20)12-13-10-11-13)18(21-2)14-7-5-6-8-15(14)19/h5-8,13,16,18H,3-4,9-12H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | PDXULFIACXEKEG-WMZOPIPTSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|