C15H24INO3 — CID 163439900
N-[[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)butan-2-yl]oxymethyl]ethanamine (PubChem CID 163439900) has the molecular formula C15H24INO3 and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)butan-2-yl]oxymethyl]ethanamine.
| Compound Name | N-[[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)butan-2-yl]oxymethyl]ethanamine |
|---|---|
| PubChem CID | 163439900 |
| Molecular Formula | C15H24INO3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)butan-2-yl]oxymethyl]ethanamine |
| SMILES | CCNCO[C@@H](CC)[C@@H](OCOC)c1ccccc1I |
| InChI | InChI=1S/C15H24INO3/c1-4-14(19-10-17-5-2)15(20-11-18-3)12-8-6-7-9-13(12)16/h6-9,14-15,17H,4-5,10-11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | AXQDDZOJLLATQC-GJZGRUSLSA-N |
| XLogP | 3.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|