C12H15F3IN — CID 104992817
N-ethyl-4,4,4-trifluoro-1-(2-iodophenyl)butan-1-amine (PubChem CID 104992817) has the molecular formula C12H15F3IN and a molecular weight of 357.16 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-1-(2-iodophenyl)butan-1-amine.
| Compound Name | N-ethyl-4,4,4-trifluoro-1-(2-iodophenyl)butan-1-amine |
|---|---|
| PubChem CID | 104992817 |
| Molecular Formula | C12H15F3IN |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-1-(2-iodophenyl)butan-1-amine |
| SMILES | CCNC(CCC(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C12H15F3IN/c1-2-17-11(7-8-12(13,14)15)9-5-3-4-6-10(9)16/h3-6,11,17H,2,7-8H2,1H3 |
| InChIKey | LMHHJJHSONURPX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|