C17H20IN — CID 63528971
N-ethyl-1-(2-iodophenyl)-2-(2-methylphenyl)ethanamine (PubChem CID 63528971) has the molecular formula C17H20IN and a molecular weight of 365.26 g/mol. Its IUPAC name is N-ethyl-1-(2-iodophenyl)-2-(2-methylphenyl)ethanamine.
| Compound Name | N-ethyl-1-(2-iodophenyl)-2-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 63528971 |
| Molecular Formula | C17H20IN |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-ethyl-1-(2-iodophenyl)-2-(2-methylphenyl)ethanamine |
| SMILES | CCNC(Cc1ccccc1C)c1ccccc1I |
| InChI | InChI=1S/C17H20IN/c1-3-19-17(15-10-6-7-11-16(15)18)12-14-9-5-4-8-13(14)2/h4-11,17,19H,3,12H2,1-2H3 |
| InChIKey | SNYHNGYWTABLNW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|