C16H16BrFIN — CID 105020566
2-(2-bromo-3-fluorophenyl)-N-ethyl-1-(2-iodophenyl)ethanamine (PubChem CID 105020566) has the molecular formula C16H16BrFIN and a molecular weight of 448.12 g/mol. Its IUPAC name is 2-(2-bromo-3-fluorophenyl)-N-ethyl-1-(2-iodophenyl)ethanamine.
| Compound Name | 2-(2-bromo-3-fluorophenyl)-N-ethyl-1-(2-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 105020566 |
| Molecular Formula | C16H16BrFIN |
| Molecular Weight | 448.12 g/mol |
| Exact Mass | 446.95 |
| IUPAC Name | 2-(2-bromo-3-fluorophenyl)-N-ethyl-1-(2-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1cccc(F)c1Br)c1ccccc1I |
| InChI | InChI=1S/C16H16BrFIN/c1-2-20-15(12-7-3-4-9-14(12)19)10-11-6-5-8-13(18)16(11)17/h3-9,15,20H,2,10H2,1H3 |
| InChIKey | RLQQPAWZXZZBNV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|