C14H14BrClFNO — CID 106692784
2-(2-bromo-3-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-ethylethanamine (PubChem CID 106692784) has the molecular formula C14H14BrClFNO and a molecular weight of 346.63 g/mol. Its IUPAC name is 2-(2-bromo-3-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-ethylethanamine.
| Compound Name | 2-(2-bromo-3-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 106692784 |
| Molecular Formula | C14H14BrClFNO |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-(2-bromo-3-fluorophenyl)-1-(5-chlorofuran-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(F)c1Br)c1ccc(Cl)o1 |
| InChI | InChI=1S/C14H14BrClFNO/c1-2-18-11(12-6-7-13(16)19-12)8-9-4-3-5-10(17)14(9)15/h3-7,11,18H,2,8H2,1H3 |
| InChIKey | PPCXZMRRRSOXRX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |