C15H16Cl2FNO — CID 106693463
N-[2-(3-chloro-2-fluorophenyl)-1-(5-chlorofuran-2-yl)ethyl]propan-1-amine (PubChem CID 106693463) has the molecular formula C15H16Cl2FNO and a molecular weight of 316.20 g/mol. Its IUPAC name is N-[2-(3-chloro-2-fluorophenyl)-1-(5-chlorofuran-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-chloro-2-fluorophenyl)-1-(5-chlorofuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106693463 |
| Molecular Formula | C15H16Cl2FNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-[2-(3-chloro-2-fluorophenyl)-1-(5-chlorofuran-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1F)c1ccc(Cl)o1 |
| InChI | InChI=1S/C15H16Cl2FNO/c1-2-8-19-12(13-6-7-14(17)20-13)9-10-4-3-5-11(16)15(10)18/h3-7,12,19H,2,8-9H2,1H3 |
| InChIKey | YNTQRNQBVURBSH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |