C15H22F3NO2 — CID 104660475
N-ethyl-4,4,4-trifluoro-1-[2-(2-methoxyethoxy)phenyl]butan-1-amine (PubChem CID 104660475) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-1-[2-(2-methoxyethoxy)phenyl]butan-1-amine.
| Compound Name | N-ethyl-4,4,4-trifluoro-1-[2-(2-methoxyethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 104660475 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-1-[2-(2-methoxyethoxy)phenyl]butan-1-amine |
| SMILES | CCNC(CCC(F)(F)F)c1ccccc1OCCOC |
| InChI | InChI=1S/C15H22F3NO2/c1-3-19-13(8-9-15(16,17)18)12-6-4-5-7-14(12)21-11-10-20-2/h4-7,13,19H,3,8-11H2,1-2H3 |
| InChIKey | PLNVNOFZMDPCAL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|