C17H29NO3 — CID 105180487
N-ethyl-4-methoxy-1-[2-(2-methoxyethoxy)phenyl]pentan-1-amine (PubChem CID 105180487) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is N-ethyl-4-methoxy-1-[2-(2-methoxyethoxy)phenyl]pentan-1-amine.
| Compound Name | N-ethyl-4-methoxy-1-[2-(2-methoxyethoxy)phenyl]pentan-1-amine |
|---|---|
| PubChem CID | 105180487 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-ethyl-4-methoxy-1-[2-(2-methoxyethoxy)phenyl]pentan-1-amine |
| SMILES | CCNC(CCC(C)OC)c1ccccc1OCCOC |
| InChI | InChI=1S/C17H29NO3/c1-5-18-16(11-10-14(2)20-4)15-8-6-7-9-17(15)21-13-12-19-3/h6-9,14,16,18H,5,10-13H2,1-4H3 |
| InChIKey | CXWOGGPMEBRCMK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|