C24H34O7 — CID 25146672
(1R,2S,3R,5S)-1,5-bis(methoxymethoxy)-1-phenyl-7-phenylmethoxyheptane-2,3-diol (PubChem CID 25146672) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-1,5-bis(methoxymethoxy)-1-phenyl-7-phenylmethoxyheptane-2,3-diol.
| Compound Name | (1R,2S,3R,5S)-1,5-bis(methoxymethoxy)-1-phenyl-7-phenylmethoxyheptane-2,3-diol |
|---|---|
| PubChem CID | 25146672 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1R,2S,3R,5S)-1,5-bis(methoxymethoxy)-1-phenyl-7-phenylmethoxyheptane-2,3-diol |
| SMILES | COCO[C@@H](CCOCc1ccccc1)C[C@@H](O)[C@H](O)[C@H](OCOC)c1ccccc1 |
| InChI | InChI=1S/C24H34O7/c1-27-17-30-21(13-14-29-16-19-9-5-3-6-10-19)15-22(25)23(26)24(31-18-28-2)20-11-7-4-8-12-20/h3-12,21-26H,13-18H2,1-2H3/t21-,22+,23-,24+/m0/s1 |
| InChIKey | GBXTYKMXDMOLCZ-UARRHKHWSA-N |
| XLogP | 3.06 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|