About (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one
(2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one (PubChem CID 135042856) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one |
| PubChem CID | 135042856 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one |
| SMILES | COCO[C@H](c1ccccc1)[C@H](O)[C@H]1CCCC1=O |
| InChI | InChI=1S/C15H20O4/c1-18-10-19-15(11-6-3-2-4-7-11)14(17)12-8-5-9-13(12)16/h2-4,6-7,12,14-15,17H,5,8-10H2,1H3/t12-,14+,15+/m0/s1 |
| InChIKey | FBCBRXRUKXQRAK-NWANDNLSSA-N |
| XLogP | 2.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one?
The IUPAC name of (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one (CID 135042856) is (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one.
What is the SMILES notation for (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one?
The canonical SMILES for (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one is COCO[C@H](c1ccccc1)[C@H](O)[C@H]1CCCC1=O.
What is the InChIKey of (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one?
The InChIKey is FBCBRXRUKXQRAK-NWANDNLSSA-N. The full InChI is InChI=1S/C15H20O4/c1-18-10-19-15(11-6-3-2-4-7-11)14(17)12-8-5-9-13(12)16/h2-4,6-7,12,14-15,17H,5,8-10H2,1H3/t12-,14+,15+/m0/s1.
What are the key properties of (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one?
(2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one has a molecular weight of 264.32 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1R,2R)-1-hydroxy-2-(methoxymethoxy)-2-phenylethyl]cyclopentan-1-one is sourced from PubChem (CID 135042856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).