C16H24F3N — CID 106024462
N-(2,2,2-trifluoro-1-phenylethyl)octan-4-amine (PubChem CID 106024462) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is N-(2,2,2-trifluoro-1-phenylethyl)octan-4-amine.
| Compound Name | N-(2,2,2-trifluoro-1-phenylethyl)octan-4-amine |
|---|---|
| PubChem CID | 106024462 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-(2,2,2-trifluoro-1-phenylethyl)octan-4-amine |
| SMILES | CCCCC(CCC)NC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H24F3N/c1-3-5-12-14(9-4-2)20-15(16(17,18)19)13-10-7-6-8-11-13/h6-8,10-11,14-15,20H,3-5,9,12H2,1-2H3 |
| InChIKey | DSPXBMDIPLPFEG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |