C17H29N3O — CID 106019347
N'-hydroxy-3-(octan-4-ylamino)-3-phenylpropanimidamide (PubChem CID 106019347) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is N'-hydroxy-3-(octan-4-ylamino)-3-phenylpropanimidamide.
| Compound Name | N'-hydroxy-3-(octan-4-ylamino)-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 106019347 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | N'-hydroxy-3-(octan-4-ylamino)-3-phenylpropanimidamide |
| SMILES | CCCCC(CCC)NC(C/C(N)=N/O)c1ccccc1 |
| InChI | InChI=1S/C17H29N3O/c1-3-5-12-15(9-4-2)19-16(13-17(18)20-21)14-10-7-6-8-11-14/h6-8,10-11,15-16,19,21H,3-5,9,12-13H2,1-2H3,(H2,18,20) |
| InChIKey | RVRZOWSELPCIRK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|