C17H23F3O — CID 15311806
[(E)-5-(trifluoromethyl)non-3-enoxy]methylbenzene (PubChem CID 15311806) has the molecular formula C17H23F3O and a molecular weight of 300.36 g/mol. Its IUPAC name is [(E)-5-(trifluoromethyl)non-3-enoxy]methylbenzene.
| Compound Name | [(E)-5-(trifluoromethyl)non-3-enoxy]methylbenzene |
|---|---|
| PubChem CID | 15311806 |
| Molecular Formula | C17H23F3O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(E)-5-(trifluoromethyl)non-3-enoxy]methylbenzene |
| SMILES | CCCCC(/C=C/CCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O/c1-2-3-11-16(17(18,19)20)12-7-8-13-21-14-15-9-5-4-6-10-15/h4-7,9-10,12,16H,2-3,8,11,13-14H2,1H3/b12-7+ |
| InChIKey | IHILRUOVYLUJAT-KPKJPENVSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|