C19H28O — CID 11601516
[(3Z,6Z)-3,7-dideuteriododeca-3,6-dienoxy]methylbenzene (PubChem CID 11601516) has the molecular formula C19H28O and a molecular weight of 274.44 g/mol. Its IUPAC name is [(3Z,6Z)-3,7-dideuteriododeca-3,6-dienoxy]methylbenzene.
| Compound Name | [(3Z,6Z)-3,7-dideuteriododeca-3,6-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 11601516 |
| Molecular Formula | C19H28O |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | [(3Z,6Z)-3,7-dideuteriododeca-3,6-dienoxy]methylbenzene |
| SMILES | [2H]/C(=C/C/C=C(/[2H])CCOCc1ccccc1)CCCCC |
| InChI | InChI=1S/C19H28O/c1-2-3-4-5-6-7-8-9-10-14-17-20-18-19-15-12-11-13-16-19/h6-7,9-13,15-16H,2-5,8,14,17-18H2,1H3/b7-6-,10-9-/i6D,10D |
| InChIKey | AYSVJROHTGOXMQ-OJSVEQJYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|