C13H16O2 — CID 100919694
[(1S,2E)-1-(methoxymethoxy)penta-2,4-dienyl]benzene (PubChem CID 100919694) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is [(1S,2E)-1-(methoxymethoxy)penta-2,4-dienyl]benzene.
| Compound Name | [(1S,2E)-1-(methoxymethoxy)penta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 100919694 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [(1S,2E)-1-(methoxymethoxy)penta-2,4-dienyl]benzene |
| SMILES | C=C/C=C/[C@H](OCOC)c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-3-4-10-13(15-11-14-2)12-8-6-5-7-9-12/h3-10,13H,1,11H2,2H3/b10-4+/t13-/m0/s1 |
| InChIKey | JBPCJDURPWBNHI-CFDVYZKQSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|