C10H9F14IS — CID 158646492
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane;3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-thiol (PubChem CID 158646492) has the molecular formula C10H9F14IS and a molecular weight of 554.12 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane;3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-thiol.
| Compound Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane;3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-thiol |
|---|---|
| PubChem CID | 158646492 |
| Molecular Formula | C10H9F14IS |
| Molecular Weight | 554.12 g/mol |
| Exact Mass | 553.92 |
| IUPAC Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane;3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-thiol |
| SMILES | FC(F)(F)C(F)(CCI)C(F)(F)F.FC(F)(F)C(F)(CCS)C(F)(F)F |
| InChI | InChI=1S/C5H4F7I.C5H5F7S/c2*6-3(1-2-13,4(7,8)9)5(10,11)12/h1-2H2;13H,1-2H2 |
| InChIKey | IBAOAEWRCAXMHF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.12 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|