C12H10F14 — CID 11133559
(E)-1,1,1,2,9,10,10,10-octafluoro-2,9-bis(trifluoromethyl)dec-5-ene (PubChem CID 11133559) has the molecular formula C12H10F14 and a molecular weight of 420.18 g/mol. Its IUPAC name is (E)-1,1,1,2,9,10,10,10-octafluoro-2,9-bis(trifluoromethyl)dec-5-ene.
| Compound Name | (E)-1,1,1,2,9,10,10,10-octafluoro-2,9-bis(trifluoromethyl)dec-5-ene |
|---|---|
| PubChem CID | 11133559 |
| Molecular Formula | C12H10F14 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (E)-1,1,1,2,9,10,10,10-octafluoro-2,9-bis(trifluoromethyl)dec-5-ene |
| SMILES | FC(F)(F)C(F)(CC/C=C/CCC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14/c13-7(9(15,16)17,10(18,19)20)5-3-1-2-4-6-8(14,11(21,22)23)12(24,25)26/h1-2H,3-6H2/b2-1+ |
| InChIKey | HYSAQVOIRKUDIH-OWOJBTEDSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|