C11H19F5O2 — CID 87558922
ethanol;(E)-8,8,9,9,9-pentafluoronon-4-en-1-ol (PubChem CID 87558922) has the molecular formula C11H19F5O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethanol;(E)-8,8,9,9,9-pentafluoronon-4-en-1-ol.
| Compound Name | ethanol;(E)-8,8,9,9,9-pentafluoronon-4-en-1-ol |
|---|---|
| PubChem CID | 87558922 |
| Molecular Formula | C11H19F5O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethanol;(E)-8,8,9,9,9-pentafluoronon-4-en-1-ol |
| SMILES | CCO.OCCC/C=C/CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O.C2H6O/c10-8(11,9(12,13)14)6-4-2-1-3-5-7-15;1-2-3/h1-2,15H,3-7H2;3H,2H2,1H3/b2-1+; |
| InChIKey | FRMPDNBESZFHAB-TYYBGVCCSA-N |
| XLogP | 3.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|