C6H4F9I — CID 97291082
(3R)-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane (PubChem CID 97291082) has the molecular formula C6H4F9I and a molecular weight of 373.98 g/mol. Its IUPAC name is (3R)-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane.
| Compound Name | (3R)-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 97291082 |
| Molecular Formula | C6H4F9I |
| Molecular Weight | 373.98 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | (3R)-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)pentane |
| SMILES | FC(F)(F)C(F)(F)[C@](F)(CCI)C(F)(F)F |
| InChI | InChI=1S/C6H4F9I/c7-3(1-2-16,5(10,11)12)4(8,9)6(13,14)15/h1-2H2/t3-/m1/s1 |
| InChIKey | AOJSNAHJSVDKPI-GSVOUGTGSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|