C16H8F20N2 — CID 174505409
2-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-3-(trifluoromethyl)nonyl]-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 174505409) has the molecular formula C16H8F20N2 and a molecular weight of 608.21 g/mol. Its IUPAC name is 2-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-3-(trifluoromethyl)nonyl]-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-3-(trifluoromethyl)nonyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 174505409 |
| Molecular Formula | C16H8F20N2 |
| Molecular Weight | 608.21 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 2-[3,4,4,5,5,6,6,7,7,8,8,9,9,9-tetradecafluoro-3-(trifluoromethyl)nonyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)CCC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H8F20N2/c17-8(15(31,32)33,3-1-7(5-37,6-38)2-4-9(18,19)20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)16(34,35)36/h1-4H2 |
| InChIKey | LUZAXEJQGDEMSQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.21 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|