C16H8F20N2O2 — CID 87731254
3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-1,12-diisocyanato-3,10-bis(trifluoromethyl)dodecane (PubChem CID 87731254) has the molecular formula C16H8F20N2O2 and a molecular weight of 640.21 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-1,12-diisocyanato-3,10-bis(trifluoromethyl)dodecane.
| Compound Name | 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-1,12-diisocyanato-3,10-bis(trifluoromethyl)dodecane |
|---|---|
| PubChem CID | 87731254 |
| Molecular Formula | C16H8F20N2O2 |
| Molecular Weight | 640.21 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,8,8,9,9,10-tetradecafluoro-1,12-diisocyanato-3,10-bis(trifluoromethyl)dodecane |
| SMILES | O=C=NCCC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(CCN=C=O)C(F)(F)F |
| InChI | InChI=1S/C16H8F20N2O2/c17-7(15(31,32)33,1-3-37-5-39)9(19,20)11(23,24)13(27,28)14(29,30)12(25,26)10(21,22)8(18,16(34,35)36)2-4-38-6-40/h1-4H2 |
| InChIKey | VFKYSLTUQBQOHD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.21 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|