C10H4F12N2O2 — CID 87182349
1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-7-isocyanato-6-(isocyanatomethyl)heptane (PubChem CID 87182349) has the molecular formula C10H4F12N2O2 and a molecular weight of 412.13 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-7-isocyanato-6-(isocyanatomethyl)heptane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-7-isocyanato-6-(isocyanatomethyl)heptane |
|---|---|
| PubChem CID | 87182349 |
| Molecular Formula | C10H4F12N2O2 |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluoro-7-isocyanato-6-(isocyanatomethyl)heptane |
| SMILES | O=C=NCC(F)(CN=C=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F12N2O2/c11-5(1-23-3-25,2-24-4-26)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)22/h1-2H2 |
| InChIKey | RTHYGEOYUAPVHW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|