C11H7F14N3 — CID 19768122
10-azido-3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)dec-1-ene (PubChem CID 19768122) has the molecular formula C11H7F14N3 and a molecular weight of 447.17 g/mol. Its IUPAC name is 10-azido-3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)dec-1-ene.
| Compound Name | 10-azido-3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)dec-1-ene |
|---|---|
| PubChem CID | 19768122 |
| Molecular Formula | C11H7F14N3 |
| Molecular Weight | 447.17 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 10-azido-3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)dec-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(CCN=[N+]=[N-])C(F)(F)F |
| InChI | InChI=1S/C11H7F14N3/c1-2-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(12,11(23,24)25)3-4-27-28-26/h2H,1,3-4H2 |
| InChIKey | GNKJNBNLINEVNP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.17 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|