C8H4F13N3O — CID 162536028
6-azido-1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2,2-pentafluoroethoxy)hexane (PubChem CID 162536028) has the molecular formula C8H4F13N3O and a molecular weight of 405.11 g/mol. Its IUPAC name is 6-azido-1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2,2-pentafluoroethoxy)hexane.
| Compound Name | 6-azido-1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2,2-pentafluoroethoxy)hexane |
|---|---|
| PubChem CID | 162536028 |
| Molecular Formula | C8H4F13N3O |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 6-azido-1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2,2-pentafluoroethoxy)hexane |
| SMILES | [N-]=[N+]=NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F13N3O/c9-3(10,1-2-23-24-22)4(11,12)5(13,14)7(18,19)25-8(20,21)6(15,16)17/h1-2H2 |
| InChIKey | DSBROTXADAHNAE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|