C10H12F3N3O — CID 71367842
2-(2-methoxyiminopropyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 71367842) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-(2-methoxyiminopropyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-(2-methoxyiminopropyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 71367842 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(2-methoxyiminopropyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | CON=C(C)CC(C#N)(C#N)CCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O/c1-8(16-17-2)5-9(6-14,7-15)3-4-10(11,12)13/h3-5H2,1-2H3 |
| InChIKey | LWXZXWMQBDTWDK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|