C12H18F9N3O3 — CID 172954181
(E)-1,1,1-trifluoro-N-methoxypropan-2-imine;bis((Z)-1,1,1-trifluoro-N-methoxypropan-2-imine) (PubChem CID 172954181) has the molecular formula C12H18F9N3O3 and a molecular weight of 423.28 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-N-methoxypropan-2-imine;bis((Z)-1,1,1-trifluoro-N-methoxypropan-2-imine).
| Compound Name | (E)-1,1,1-trifluoro-N-methoxypropan-2-imine;bis((Z)-1,1,1-trifluoro-N-methoxypropan-2-imine) |
|---|---|
| PubChem CID | 172954181 |
| Molecular Formula | C12H18F9N3O3 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (E)-1,1,1-trifluoro-N-methoxypropan-2-imine;bis((Z)-1,1,1-trifluoro-N-methoxypropan-2-imine) |
| SMILES | CO/N=C(/C)C(F)(F)F.CO/N=C(/C)C(F)(F)F.CO/N=C(\C)C(F)(F)F |
| InChI | InChI=1S/3C4H6F3NO/c3*1-3(8-9-2)4(5,6)7/h3*1-2H3/b8-3+;2*8-3- |
| InChIKey | QIWDWMNGBBEIJG-CESJWALISA-N |
| XLogP | 4.71 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|