C10H12ClF3N2 — CID 87395514
2-(4-chlorobutyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 87395514) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-(4-chlorobutyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 87395514 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(4-chlorobutyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCCCCl)CCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2/c11-6-2-1-3-9(7-15,8-16)4-5-10(12,13)14/h1-6H2 |
| InChIKey | WYHDZAUPNBEXTK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|