C13H10F3N3O2 — CID 22235017
2-[(4-nitrophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 22235017) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-[(4-nitrophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 22235017 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)6-5-12(8-17,9-18)7-10-1-3-11(4-2-10)19(20)21/h1-4H,5-7H2 |
| InChIKey | QMUKPMVSIKOJNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|