C11H9F3N4O2 — CID 86612672
2-[(3-nitropyrrol-1-yl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 86612672) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-[(3-nitropyrrol-1-yl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-[(3-nitropyrrol-1-yl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 86612672 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[(3-nitropyrrol-1-yl)methyl]-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)Cn1ccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)3-2-10(6-15,7-16)8-17-4-1-9(5-17)18(19)20/h1,4-5H,2-3,8H2 |
| InChIKey | AQQYRKSUMVPDFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|