C11H8F3N3O4 — CID 79264850
3-(4-nitrophenyl)-1-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione (PubChem CID 79264850) has the molecular formula C11H8F3N3O4 and a molecular weight of 303.20 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 3-(4-nitrophenyl)-1-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79264850 |
| Molecular Formula | C11H8F3N3O4 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(4-nitrophenyl)-1-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(CC(F)(F)F)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H8F3N3O4/c12-11(13,14)6-15-5-9(18)16(10(15)19)7-1-3-8(4-2-7)17(20)21/h1-4H,5-6H2 |
| InChIKey | DXGDIJVHOADCQS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|