C13H9F4N3O2 — CID 173274431
4-[3-(2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 173274431) has the molecular formula C13H9F4N3O2 and a molecular weight of 315.23 g/mol. Its IUPAC name is 4-[3-(2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 173274431 |
| Molecular Formula | C13H9F4N3O2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[3-(2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)CN(CCF)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9F4N3O2/c14-3-4-19-7-11(21)20(12(19)22)9-2-1-8(6-18)10(5-9)13(15,16)17/h1-2,5H,3-4,7H2 |
| InChIKey | YMRDCBKESUCZRT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|