C14H8F4N4O2 — CID 67651392
4-[3-(1-cyano-2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 67651392) has the molecular formula C14H8F4N4O2 and a molecular weight of 340.24 g/mol. Its IUPAC name is 4-[3-(1-cyano-2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(1-cyano-2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 67651392 |
| Molecular Formula | C14H8F4N4O2 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[3-(1-cyano-2-fluoroethyl)-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)CN(C(C#N)CF)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C14H8F4N4O2/c15-4-10(6-20)21-7-12(23)22(13(21)24)9-2-1-8(5-19)11(3-9)14(16,17)18/h1-3,10H,4,7H2 |
| InChIKey | ZSZAXRLBCVLDTL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|