C16H10F3N3O2 — CID 23598962
4-[(1S,6R,7R)-3,5-dioxo-2,4-diazatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 23598962) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 4-[(1S,6R,7R)-3,5-dioxo-2,4-diazatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,6R,7R)-3,5-dioxo-2,4-diazatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 23598962 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-[(1S,6R,7R)-3,5-dioxo-2,4-diazatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3[C@H]4C=C[C@H](C4)N3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10F3N3O2/c17-16(18,19)12-6-11(4-2-9(12)7-20)22-14(23)13-8-1-3-10(5-8)21(13)15(22)24/h1-4,6,8,10,13H,5H2/t8-,10+,13+/m0/s1 |
| InChIKey | IDBPESZZMOUJGT-IYYTYJHQSA-N |
| XLogP | 2.67 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|