C16H11F3N2O3S — CID 69266655
2-(trifluoromethyl)-4-[(1S,2R,6R,7R)-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile (PubChem CID 69266655) has the molecular formula C16H11F3N2O3S and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[(1S,2R,6R,7R)-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-[(1S,2R,6R,7R)-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
|---|---|
| PubChem CID | 69266655 |
| Molecular Formula | C16H11F3N2O3S |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-(trifluoromethyl)-4-[(1S,2R,6R,7R)-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3[C@@H]([C@@H]4C=C[C@H]3C4)S2(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H11F3N2O3S/c17-16(18,19)12-6-11(4-3-10(12)7-20)21-15(22)13-8-1-2-9(5-8)14(13)25(21,23)24/h1-4,6,8-9,13-14H,5H2/t8-,9+,13-,14+/m0/s1 |
| InChIKey | QBEMQSSTAOQZHO-KNUWBNEDSA-N |
| XLogP | 2.44 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|