C24H21F3N2O3SSi — CID 69268333
4-[(1R,2S,6R,7R,10R)-10-[dimethyl(phenyl)silyl]-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 69268333) has the molecular formula C24H21F3N2O3SSi and a molecular weight of 502.59 g/mol. Its IUPAC name is 4-[(1R,2S,6R,7R,10R)-10-[dimethyl(phenyl)silyl]-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2S,6R,7R,10R)-10-[dimethyl(phenyl)silyl]-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69268333 |
| Molecular Formula | C24H21F3N2O3SSi |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 4-[(1R,2S,6R,7R,10R)-10-[dimethyl(phenyl)silyl]-3,3,5-trioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1[C@@H]2C=C[C@H]1[C@@H]1[C@H]2C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)S1(=O)=O |
| InChI | InChI=1S/C24H21F3N2O3SSi/c1-34(2,16-6-4-3-5-7-16)22-17-10-11-18(22)21-20(17)23(30)29(33(21,31)32)15-9-8-14(13-28)19(12-15)24(25,26)27/h3-12,17-18,20-22H,1-2H3/t17-,18+,20+,21-,22-/m1/s1 |
| InChIKey | WGDSCLMBNRAAMC-OCFWJZSCSA-N |
| XLogP | 4.04 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|