C18H12F3N3O2 — CID 173120537
4-[(5R)-5-methyl-2,4-dioxo-5-phenylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 173120537) has the molecular formula C18H12F3N3O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is 4-[(5R)-5-methyl-2,4-dioxo-5-phenylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(5R)-5-methyl-2,4-dioxo-5-phenylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 173120537 |
| Molecular Formula | C18H12F3N3O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[(5R)-5-methyl-2,4-dioxo-5-phenylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@]1(c2ccccc2)C(=O)NC(=O)N1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3N3O2/c1-17(12-5-3-2-4-6-12)15(25)23-16(26)24(17)13-8-7-11(10-22)14(9-13)18(19,20)21/h2-9H,1H3,(H,23,25,26)/t17-/m1/s1 |
| InChIKey | UZQAJDALEYEHOU-QGZVFWFLSA-N |
| XLogP | 3.55 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|