C19H14F3N3O4S — CID 91244002
4-(4-methyl-3-methylsulfonyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 91244002) has the molecular formula C19H14F3N3O4S and a molecular weight of 437.40 g/mol. Its IUPAC name is 4-(4-methyl-3-methylsulfonyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4-methyl-3-methylsulfonyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91244002 |
| Molecular Formula | C19H14F3N3O4S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 4-(4-methyl-3-methylsulfonyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(c2ccccc2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1S(C)(=O)=O |
| InChI | InChI=1S/C19H14F3N3O4S/c1-18(13-6-4-3-5-7-13)16(26)24(17(27)25(18)30(2,28)29)14-9-8-12(11-23)15(10-14)19(20,21)22/h3-10H,1-2H3 |
| InChIKey | MDWQQPBJPDZJFF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|