C19H14F3N3O3S — CID 87317776
4-[4-(4-hydroxyphenyl)-4-methyl-3-methylsulfanyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 87317776) has the molecular formula C19H14F3N3O3S and a molecular weight of 421.40 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)-4-methyl-3-methylsulfanyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(4-hydroxyphenyl)-4-methyl-3-methylsulfanyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87317776 |
| Molecular Formula | C19H14F3N3O3S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)-4-methyl-3-methylsulfanyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CSN1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H14F3N3O3S/c1-18(12-4-7-14(26)8-5-12)16(27)24(17(28)25(18)29-2)13-6-3-11(10-23)15(9-13)19(20,21)22/h3-9,26H,1-2H3 |
| InChIKey | BPLQOMOJIYNWKH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|