C23H18F3N3O6 — CID 89092990
[4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl] prop-1-en-2-yl carbonate (PubChem CID 89092990) has the molecular formula C23H18F3N3O6 and a molecular weight of 489.41 g/mol. Its IUPAC name is [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl] prop-1-en-2-yl carbonate.
| Compound Name | [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl] prop-1-en-2-yl carbonate |
|---|---|
| PubChem CID | 89092990 |
| Molecular Formula | C23H18F3N3O6 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(hydroxymethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl] prop-1-en-2-yl carbonate |
| SMILES | C=C(C)OC(=O)Oc1ccc(C2(C)C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)N2CO)cc1 |
| InChI | InChI=1S/C23H18F3N3O6/c1-13(2)34-21(33)35-17-8-5-15(6-9-17)22(3)19(31)29(20(32)28(22)12-30)16-7-4-14(11-27)18(10-16)23(24,25)26/h4-10,30H,1,12H2,2-3H3 |
| InChIKey | XNTINTLTNQLJDV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|