C16H13F3N2O3S — CID 59529725
4-[(1R,2R,6R,7R)-7-methyl-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59529725) has the molecular formula C16H13F3N2O3S and a molecular weight of 370.35 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7R)-7-methyl-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6R,7R)-7-methyl-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59529725 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 4-[(1R,2R,6R,7R)-7-methyl-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12C=C[C@@H](O1)[C@H]1[C@@H]2CN(c2ccc(C#N)c(C(F)(F)F)c2)S1(=O)=O |
| InChI | InChI=1S/C16H13F3N2O3S/c1-15-5-4-13(24-15)14-12(15)8-21(25(14,22)23)10-3-2-9(7-20)11(6-10)16(17,18)19/h2-6,12-14H,8H2,1H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | CUSFCAWMGHZYAB-GBJTYRQASA-N |
| XLogP | 2.44 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|