C15H12F4N2O3S — CID 68514442
4-[(1S,2R,6R,7S,8S)-8-fluoro-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68514442) has the molecular formula C15H12F4N2O3S and a molecular weight of 376.33 g/mol. Its IUPAC name is 4-[(1S,2R,6R,7S,8S)-8-fluoro-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,2R,6R,7S,8S)-8-fluoro-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68514442 |
| Molecular Formula | C15H12F4N2O3S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 4-[(1S,2R,6R,7S,8S)-8-fluoro-3,3-dioxo-10-oxa-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@@H]3[C@@H]4O[C@@H](C[C@@H]4F)[C@@H]3S2(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H12F4N2O3S/c16-11-4-12-14-9(13(11)24-12)6-21(25(14,22)23)8-2-1-7(5-20)10(3-8)15(17,18)19/h1-3,9,11-14H,4,6H2/t9-,11+,12+,13+,14-/m1/s1 |
| InChIKey | AQUDDASGTQMNMZ-KYLSFTOHSA-N |
| XLogP | 2.22 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |