C16H15F3N2O4S — CID 24851950
4-[(1R,2S,6R,7S,8S,9R)-8,9-dihydroxy-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 24851950) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-[(1R,2S,6R,7S,8S,9R)-8,9-dihydroxy-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2S,6R,7S,8S,9R)-8,9-dihydroxy-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 24851950 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-[(1R,2S,6R,7S,8S,9R)-8,9-dihydroxy-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H]3[C@@H]4C[C@H]([C@@H](O)[C@H]4O)[C@H]3S2(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O4S/c17-16(18,19)12-3-8(2-1-7(12)5-20)21-6-11-9-4-10(14(23)13(9)22)15(11)26(21,24)25/h1-3,9-11,13-15,22-23H,4,6H2/t9-,10+,11-,13-,14+,15+/m0/s1 |
| InChIKey | TVLQWYDJSMRVHL-CIAPJOBCSA-N |
| XLogP | 1.08 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |